CAS 1936241-21-2 is the registry number for 2,6-Dichloro-5-methoxypyrimidine-4-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2,6-dichloro-5-methoxypyrimidine-4-carboxylic acid (CAS 1936241-21-2) is a chemical compound with the molecular formula C6H4Cl2N2O3 and a molecular weight of 223.01 g/mol. IUPAC name: 2,6-dichloro-5-methoxypyrimidine-4-carboxylic acid. InChIKey: RMXQJMZYYBRLHW-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N2O3 |
|---|---|
| Molecular weight | 223.01 g/mol |
| IUPAC name | 2,6-dichloro-5-methoxypyrimidine-4-carboxylic acid |
| InChIKey | RMXQJMZYYBRLHW-UHFFFAOYSA-N |
| SMILES | COC1=C(N=C(N=C1Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)