Products 1936247-74-3
CAS 1936247-74-3 is the registry number for 2-(6-Nitropyridin-3-yl)acetonitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
2-(6-nitro-3-pyridinyl)acetonitrile (CAS 1936247-74-3) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: 2-(6-nitro-3-pyridinyl)acetonitrile. InChIKey: OBYRLCRDBFCKHJ-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 2-(6-nitro-3-pyridinyl)acetonitrile |
| InChIKey | OBYRLCRDBFCKHJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1CC#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)