Products 1936259-87-8

CAS 1936259-87-8 is the registry number for Furan-2-sulfonyl fluoride, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Furan-2-sulfonyl fluoride (CAS 1936259-87-8) is a chemical compound with the molecular formula C4H3FO3S and a molecular weight of 150.13 g/mol. IUPAC name: furan-2-sulfonyl fluoride. InChIKey: BBHDFVVERNYQIT-UHFFFAOYSA-N.

Identity
Molecular formulaC4H3FO3S
Molecular weight150.13 g/mol
IUPAC namefuran-2-sulfonyl fluoride
InChIKeyBBHDFVVERNYQIT-UHFFFAOYSA-N
SMILESC1=COC(=C1)S(=O)(=O)F

Computed by PubChem (NCBI)