CAS 193629-25-3 appears in our catalog under these names: 2,3-Diaminophenol dihydrochloride, 95%, 2,3-Diaminophenol dihydrochloride, 95+%, 2,3-Diaminophenol dihydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg.
2,3-diaminophenol;dihydrochloride (CAS 193629-25-3) is a chemical compound with the molecular formula C6H10Cl2N2O and a molecular weight of 197.06 g/mol. IUPAC name: 2,3-diaminophenol;dihydrochloride. InChIKey: BADQZTVDULCXNA-UHFFFAOYSA-N.
| Molecular formula | C6H10Cl2N2O |
|---|---|
| Molecular weight | 197.06 g/mol |
| IUPAC name | 2,3-diaminophenol;dihydrochloride |
| InChIKey | BADQZTVDULCXNA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)N)N.Cl.Cl |
Computed by PubChem (NCBI)