CAS 1936430-29-3 is the registry number for tert-Butyl 6-(difluoromethyl)indoline-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 6-(difluoromethyl)-2,3-dihydroindole-1-carboxylate (CAS 1936430-29-3) is a chemical compound with the molecular formula C14H17F2NO2 and a molecular weight of 269.29 g/mol. IUPAC name: tert-butyl 6-(difluoromethyl)-2,3-dihydroindole-1-carboxylate. InChIKey: FRCSJKIDPJUPLC-UHFFFAOYSA-N.
| Molecular formula | C14H17F2NO2 |
|---|---|
| Molecular weight | 269.29 g/mol |
| IUPAC name | tert-butyl 6-(difluoromethyl)-2,3-dihydroindole-1-carboxylate |
| InChIKey | FRCSJKIDPJUPLC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C1C=C(C=C2)C(F)F |
Computed by PubChem (NCBI)