Products 1936555-43-9
CAS 1936555-43-9 is the registry number for tert-Butyl 2,3,5-trimethylpiperazine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Tert-butyl 2,3,5-trimethylpiperazine-1-carboxylate (CAS 1936555-43-9) is a chemical compound with the molecular formula C12H24N2O2 and a molecular weight of 228.33 g/mol. IUPAC name: tert-butyl 2,3,5-trimethylpiperazine-1-carboxylate. InChIKey: IPQYEIDFNYVNKF-UHFFFAOYSA-N.
| Molecular formula | C12H24N2O2 |
|---|---|
| Molecular weight | 228.33 g/mol |
| IUPAC name | tert-butyl 2,3,5-trimethylpiperazine-1-carboxylate |
| InChIKey | IPQYEIDFNYVNKF-UHFFFAOYSA-N |
| SMILES | CC1CN(C(C(N1)C)C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)