Products 1936729-45-1

CAS 1936729-45-1 is the registry number for Ethyl 2-(chlorosulfonyl)-2-fluoroacetate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Ethyl 2-chlorosulfonyl-2-fluoroacetate (CAS 1936729-45-1) is a chemical compound with the molecular formula C4H6ClFO4S and a molecular weight of 204.61 g/mol. IUPAC name: ethyl 2-chlorosulfonyl-2-fluoroacetate. InChIKey: WNTNRSISUKPNMS-UHFFFAOYSA-N.

Identity
Molecular formulaC4H6ClFO4S
Molecular weight204.61 g/mol
IUPAC nameethyl 2-chlorosulfonyl-2-fluoroacetate
InChIKeyWNTNRSISUKPNMS-UHFFFAOYSA-N
SMILESCCOC(=O)C(F)S(=O)(=O)Cl

Computed by PubChem (NCBI)