Products 19368-25-3

CAS 19368-25-3 is the registry number for 2-((3,5-Dichlorophenyl)carbamoyl)benzoic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

2-[(3,5-dichlorophenyl)carbamoyl]benzoic acid (CAS 19368-25-3) is a chemical compound with the molecular formula C14H9Cl2NO3 and a molecular weight of 310.1 g/mol. IUPAC name: 2-[(3,5-dichlorophenyl)carbamoyl]benzoic acid. InChIKey: KJJDJHRRNYTTRI-UHFFFAOYSA-N.

Identity
Molecular formulaC14H9Cl2NO3
Molecular weight310.1 g/mol
IUPAC name2-[(3,5-dichlorophenyl)carbamoyl]benzoic acid
InChIKeyKJJDJHRRNYTTRI-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=O)NC2=CC(=CC(=C2)Cl)Cl)C(=O)O

Computed by PubChem (NCBI)