CAS 1938080-43-3 appears in our catalog under these names: 2-((6-Ethoxy-3-methyl-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)methyl)-4-fluorobenzonitrile, 98%, Trelagliptin Impurity 56, Trelagliptin Impurity 27. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(6-ethoxy-3-methyl-2,4-dioxopyrimidin-1-yl)methyl]-4-fluorobenzonitrile (CAS 1938080-43-3) is a chemical compound with the molecular formula C15H14FN3O3 and a molecular weight of 303.29 g/mol. IUPAC name: 2-[(6-ethoxy-3-methyl-2,4-dioxopyrimidin-1-yl)methyl]-4-fluorobenzonitrile. InChIKey: KHSDYNZVVJTXDD-UHFFFAOYSA-N.
| Molecular formula | C15H14FN3O3 |
|---|---|
| Molecular weight | 303.29 g/mol |
| IUPAC name | 2-[(6-ethoxy-3-methyl-2,4-dioxopyrimidin-1-yl)methyl]-4-fluorobenzonitrile |
| InChIKey | KHSDYNZVVJTXDD-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=O)N(C(=O)N1CC2=C(C=CC(=C2)F)C#N)C |
Computed by PubChem (NCBI)