CAS 1938090-31-3 appears in our catalog under these names: Dapagliflozin Impurity 59, Dapagliflozin Impurity 146. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,2S,3R,4R,5R)-1-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]hexane-1,2,3,4,5,6-hexol (CAS 1938090-31-3) is a chemical compound with the molecular formula C21H27ClO7 and a molecular weight of 426.9 g/mol. IUPAC name: (1S,2S,3R,4R,5R)-1-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]hexane-1,2,3,4,5,6-hexol. InChIKey: QXLZASULNNCSEF-TXVWBRJLSA-N.
| Molecular formula | C21H27ClO7 |
|---|---|
| Molecular weight | 426.9 g/mol |
| IUPAC name | (1S,2S,3R,4R,5R)-1-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]hexane-1,2,3,4,5,6-hexol |
| InChIKey | QXLZASULNNCSEF-TXVWBRJLSA-N |
| SMILES | CCOC1=CC=C(C=C1)CC2=C(C=CC(=C2)[C@@H]([C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O)O)Cl |
Computed by PubChem (NCBI)