CAS 1938456-46-2 is the registry number for (2R,6S)-2,6-dimethyl-4-(4-piperidinylmethyl)morpholine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(2S,6R)-2,6-dimethyl-4-(piperidin-4-ylmethyl)morpholine (CAS 1938456-46-2) is a chemical compound with the molecular formula C12H24N2O and a molecular weight of 212.33 g/mol. IUPAC name: (2S,6R)-2,6-dimethyl-4-(piperidin-4-ylmethyl)morpholine. InChIKey: SXCAMRDUPBADFT-PHIMTYICSA-N.
| Molecular formula | C12H24N2O |
|---|---|
| Molecular weight | 212.33 g/mol |
| IUPAC name | (2S,6R)-2,6-dimethyl-4-(piperidin-4-ylmethyl)morpholine |
| InChIKey | SXCAMRDUPBADFT-PHIMTYICSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](O1)C)CC2CCNCC2 |
Computed by PubChem (NCBI)