CAS 19385-96-7 appears in our catalog under these names: 5,7-Dimethyladamantane-1,3-diamine, 5,7-Dimethyladamantane-1,3-diamine, 95%, 5,7-Dimethyl-1,3-adamantanediamine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 2,5g.
5,7-dimethyladamantane-1,3-diamine (CAS 19385-96-7) is a chemical compound with the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. IUPAC name: 5,7-dimethyladamantane-1,3-diamine. InChIKey: KFINWPLSLFZOSU-UHFFFAOYSA-N.
| Molecular formula | C12H22N2 |
|---|---|
| Molecular weight | 194.32 g/mol |
| IUPAC name | 5,7-dimethyladamantane-1,3-diamine |
| InChIKey | KFINWPLSLFZOSU-UHFFFAOYSA-N |
| SMILES | CC12CC3(CC(C1)(CC(C2)(C3)N)N)C |
Computed by PubChem (NCBI)