CAS 194-65-0 is the registry number for Dinaphtho(2,1-b:1,2-d)thiophene, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g.
12-thiapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene (CAS 194-65-0) is a chemical compound with the molecular formula C20H12S and a molecular weight of 284.4 g/mol. IUPAC name: 12-thiapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene. InChIKey: JFNCOYXPHARAMI-UHFFFAOYSA-N.
| Molecular formula | C20H12S |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | 12-thiapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene |
| InChIKey | JFNCOYXPHARAMI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C4=C(S3)C=CC5=CC=CC=C54 |
Computed by PubChem (NCBI)