CAS 1940173-83-0 is the registry number for Antibacterial agent 167. Offered by: MedChemExpress. Available pack sizes: Get quote.
Sodium 4-[4-(trifluoromethyl)phenyl]piperazine-1-carbothioate (CAS 1940173-83-0) is a chemical compound with the molecular formula C12H12F3N2NaOS and a molecular weight of 312.29 g/mol. IUPAC name: sodium 4-[4-(trifluoromethyl)phenyl]piperazine-1-carbothioate. InChIKey: OPBYPLLCHQENHU-UHFFFAOYSA-M.
| Molecular formula | C12H12F3N2NaOS |
|---|---|
| Molecular weight | 312.29 g/mol |
| IUPAC name | sodium 4-[4-(trifluoromethyl)phenyl]piperazine-1-carbothioate |
| InChIKey | OPBYPLLCHQENHU-UHFFFAOYSA-M |
| SMILES | C1CN(CCN1C2=CC=C(C=C2)C(F)(F)F)C(=O)[S-].[Na+] |
Computed by PubChem (NCBI)