Products 194032-45-6

CAS 194032-45-6 is the registry number for tert-Butyl 5,7-dimethyl-1,4-diazepane-1-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl 5,7-dimethyl-1,4-diazepane-1-carboxylate (CAS 194032-45-6) is a chemical compound with the molecular formula C12H24N2O2 and a molecular weight of 228.33 g/mol. IUPAC name: tert-butyl 5,7-dimethyl-1,4-diazepane-1-carboxylate. InChIKey: WHVGKESWDHMHIR-UHFFFAOYSA-N.

Identity
Molecular formulaC12H24N2O2
Molecular weight228.33 g/mol
IUPAC nametert-butyl 5,7-dimethyl-1,4-diazepane-1-carboxylate
InChIKeyWHVGKESWDHMHIR-UHFFFAOYSA-N
SMILESCC1CC(N(CCN1)C(=O)OC(C)(C)C)C

Computed by PubChem (NCBI)