CAS 19405-26-6 is the registry number for H-Lys-Leu-OH·HBr. Offered by: Biosynth. Available pack sizes: 1000mg, 2000mg, 5000mg.
Lys-Leu is a dipeptide formed from L-lysine and L-leucine residues. It has a role as a metabolite.
Source: ChEBI
| Molecular formula | C12H25N3O3 |
|---|---|
| Molecular weight | 259.35 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-4-methylpentanoic acid |
| InChIKey | ATIPDCIQTUXABX-UWVGGRQHSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)[C@H](CCCCN)N |
Computed by PubChem (NCBI)