CAS 194086-27-6 is the registry number for (2R,3R)-1-Chloro-2-hydroxy-3-((benzyloxycarbonyl)amino)-4-(phenylthio)butane. Offered by: TRC. Available pack sizes: 100mg.
Benzyl N-[(2R,3R)-4-chloro-3-hydroxy-1-phenylsulfanylbutan-2-yl]carbamate (CAS 194086-27-6) is a chemical compound with the molecular formula C18H20ClNO3S and a molecular weight of 365.9 g/mol. IUPAC name: benzyl N-[(2R,3R)-4-chloro-3-hydroxy-1-phenylsulfanylbutan-2-yl]carbamate. InChIKey: YMCLVAZUQJPLTE-IRXDYDNUSA-N.
| Molecular formula | C18H20ClNO3S |
|---|---|
| Molecular weight | 365.9 g/mol |
| IUPAC name | benzyl N-[(2R,3R)-4-chloro-3-hydroxy-1-phenylsulfanylbutan-2-yl]carbamate |
| InChIKey | YMCLVAZUQJPLTE-IRXDYDNUSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CSC2=CC=CC=C2)[C@H](CCl)O |
Computed by PubChem (NCBI)