CAS 1941-24-8 appears in our catalog under these names: Tetramethylammonium nitrate, Tetramethylammonium Nitrate, >98.0%(T). Offered by: GLPBio, TCI. Available pack sizes: 100g, 500g, 5g, 25g.
Tetramethylazanium nitrate (CAS 1941-24-8) is a chemical compound with the molecular formula C4H12N2O3 and a molecular weight of 136.15 g/mol. IUPAC name: tetramethylazanium nitrate. InChIKey: QGPVYHSXZFOSRL-UHFFFAOYSA-N.
| Molecular formula | C4H12N2O3 |
|---|---|
| Molecular weight | 136.15 g/mol |
| IUPAC name | tetramethylazanium nitrate |
| InChIKey | QGPVYHSXZFOSRL-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)C.[N+](=O)([O-])[O-] |
Computed by PubChem (NCBI)