CAS 1941-26-0 appears in our catalog under these names: Tetraethylammonium Nitrate, Tetraethylammonium Nitrate, >98.0%(T), Tetraethylammonium nitrate, 98%, TETRAETHYLAMMONIUM NITRATE, >=98.0% N&, Tetraethylammonium (nitrate), 99.87%. Offered by: GLPBio, TCI, Thermo Scientific (Acros), Sigma-Aldrich, MedChemExpress. Available pack sizes: 100g, 500g, 5g, 25g, 10g, 50 g, 100 g, 1 g.
Tetraethylazanium nitrate (CAS 1941-26-0) is a chemical compound with the molecular formula C8H20N2O3 and a molecular weight of 192.26 g/mol. IUPAC name: tetraethylazanium nitrate. InChIKey: JTJKNAJRGLQKDZ-UHFFFAOYSA-N.
| Molecular formula | C8H20N2O3 |
|---|---|
| Molecular weight | 192.26 g/mol |
| IUPAC name | tetraethylazanium nitrate |
| InChIKey | JTJKNAJRGLQKDZ-UHFFFAOYSA-N |
| SMILES | CC[N+](CC)(CC)CC.[N+](=O)([O-])[O-] |
Computed by PubChem (NCBI)