CAS 1941048-24-3 is the registry number for 1-{(4-(Trifluoromethyl)-1,3-thiazol-2-yl)methyl}piperazine dihydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-(piperazin-1-ylmethyl)-4-(trifluoromethyl)-1,3-thiazole;dihydrochloride (CAS 1941048-24-3) is a chemical compound with the molecular formula C9H14Cl2F3N3S and a molecular weight of 324.19 g/mol. IUPAC name: 2-(piperazin-1-ylmethyl)-4-(trifluoromethyl)-1,3-thiazole;dihydrochloride. InChIKey: XFVLGPDJEOSXRO-UHFFFAOYSA-N.
| Molecular formula | C9H14Cl2F3N3S |
|---|---|
| Molecular weight | 324.19 g/mol |
| IUPAC name | 2-(piperazin-1-ylmethyl)-4-(trifluoromethyl)-1,3-thiazole;dihydrochloride |
| InChIKey | XFVLGPDJEOSXRO-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC2=NC(=CS2)C(F)(F)F.Cl.Cl |
Computed by PubChem (NCBI)