CAS 1941213-08-6 appears in our catalog under these names: cis-tert-Butyl 4-fluoro-3-hydroxypiperidine-1-carboxylate 95%, cis-tert-Butyl 4-fluoro-3-hydroxypiperidine-1-carboxylate, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Tert-butyl (3S,4R)-4-fluoro-3-hydroxypiperidine-1-carboxylate (CAS 1941213-08-6) is a chemical compound with the molecular formula C10H18FNO3 and a molecular weight of 219.25 g/mol. IUPAC name: tert-butyl (3S,4R)-4-fluoro-3-hydroxypiperidine-1-carboxylate. InChIKey: FZAKOAFETOZBLC-SFYZADRCSA-N.
| Molecular formula | C10H18FNO3 |
|---|---|
| Molecular weight | 219.25 g/mol |
| IUPAC name | tert-butyl (3S,4R)-4-fluoro-3-hydroxypiperidine-1-carboxylate |
| InChIKey | FZAKOAFETOZBLC-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]([C@H](C1)O)F |
Computed by PubChem (NCBI)