CAS 19422-37-8 appears in our catalog under these names: Flunarizine Impurity 17, 1,1,2,2-Tetrakis(4-fluorophenyl)ethane, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg.
1-fluoro-4-[1,2,2-tris(4-fluorophenyl)ethyl]benzene (CAS 19422-37-8) is a chemical compound with the molecular formula C26H18F4 and a molecular weight of 406.4 g/mol. IUPAC name: 1-fluoro-4-[1,2,2-tris(4-fluorophenyl)ethyl]benzene. InChIKey: JCHZLQOXLOBQKQ-UHFFFAOYSA-N.
| Molecular formula | C26H18F4 |
|---|---|
| Molecular weight | 406.4 g/mol |
| IUPAC name | 1-fluoro-4-[1,2,2-tris(4-fluorophenyl)ethyl]benzene |
| InChIKey | JCHZLQOXLOBQKQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C2=CC=C(C=C2)F)C(C3=CC=C(C=C3)F)C4=CC=C(C=C4)F)F |
Computed by PubChem (NCBI)