CAS 194228-60-9 is the registry number for 2,6,7–TRICHLORO–3–IODOIMIDAZO(1,2–A)PYRIDINE. Offered by: GLPBio. Available pack sizes: 200mg.
2,6,7-trichloro-3-iodoimidazo[1,2-a]pyridine (CAS 194228-60-9) is a chemical compound with the molecular formula C7H2Cl3IN2 and a molecular weight of 347.4 g/mol. IUPAC name: 2,6,7-trichloro-3-iodoimidazo[1,2-a]pyridine. InChIKey: VJLMFIOCNLMYFY-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl3IN2 |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | 2,6,7-trichloro-3-iodoimidazo[1,2-a]pyridine |
| InChIKey | VJLMFIOCNLMYFY-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN2C1=NC(=C2I)Cl)Cl)Cl |
Computed by PubChem (NCBI)