Products 194241-83-3
CAS 194241-83-3 appears in our catalog under these names: Ceftazidime EP Impurity G, Ceftazidime Impurity 7（Ceftazidime EP Impurity G）, Ceftazidime impurity G, (E)-2-(((2-(2-AMinothiazol-4-yl)-3-oxo-3-((2-oxoethyl)aMino)prop-1-en-1-yl)aMino)oxy)-2-Methylpropanoic Acid, 95%, 95%. Offered by: Chemat Brand, Hubei YoungXin, Biosynth, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 0,5mg.
2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-oxo-2-(2-oxoethylamino)ethylidene]amino]oxy-2-methylpropanoic acid (CAS 194241-83-3) is a chemical compound with the molecular formula C11H14N4O5S and a molecular weight of 314.32 g/mol. IUPAC name: 2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-oxo-2-(2-oxoethylamino)ethylidene]amino]oxy-2-methylpropanoic acid. InChIKey: XARVANDLQOZMMJ-CHHVJCJISA-N.
| Molecular formula | C11H14N4O5S |
|---|---|
| Molecular weight | 314.32 g/mol |
| IUPAC name | 2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-oxo-2-(2-oxoethylamino)ethylidene]amino]oxy-2-methylpropanoic acid |
| InChIKey | XARVANDLQOZMMJ-CHHVJCJISA-N |
| SMILES | CC(C)(C(=O)O)O/N=C(/C1=CSC(=N1)N)\C(=O)NCC=O |
Computed by PubChem (NCBI)
Synonyms:
Ceftazidime impurity G [EP], Ceftazidime specified impurity G [EP], Ceftazidime pentahydrate impurity G [EP], CEFTAZIDIME IMPURITY G [EP IMPURITY], CEFTAZIDIME PENTAHYDRATE IMPURITY G [EP IMPURITY], Ceftazidime Impurity G, CEFTAZIDIME IMPURITY G (EP IMPURITY), CEFTAZIDIME PENTAHYDRATE IMPURITY G (EP IMPURITY), Ceftazidime specified impurity G, Ceftazidime pentahydrate impurity G