CAS 19427-28-2 is the registry number for (S)-2-Formamidosuccinic acid, 95%(NMR),RG, 95%(NMR),RG. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
N-formyl-L-aspartic acid is a N-formyl amino acid that is the N-formyl-derivative of L-aspartic acid. It has a role as a mouse metabolite. It is a N-acyl-L-aspartic acid and a N-formyl amino acid. It is a conjugate acid of a N-formyl-L-aspartate(2-).
Source: ChEBI
| Molecular formula | C5H7NO5 |
|---|---|
| Molecular weight | 161.11 g/mol |
| IUPAC name | (2S)-2-formamidobutanedioic acid |
| InChIKey | MQUUQXIFCBBFDP-VKHMYHEASA-N |
| SMILES | C([C@@H](C(=O)O)NC=O)C(=O)O |
Computed by PubChem (NCBI)