CAS 1942810-35-6 is the registry number for 2,2,3,3,3-Pentafluoro-N-(4-fluorophenyl)propenamide . Offered by: TRC. Available pack sizes: 10g.
2,2,3,3,3-pentafluoro-N-(3,4,5-trifluorophenyl)propanamide (CAS 1942810-35-6) is a chemical compound with the molecular formula C9H3F8NO and a molecular weight of 293.11 g/mol. IUPAC name: 2,2,3,3,3-pentafluoro-N-(3,4,5-trifluorophenyl)propanamide. InChIKey: FRDNQNHGZPGINK-UHFFFAOYSA-N.
| Molecular formula | C9H3F8NO |
|---|---|
| Molecular weight | 293.11 g/mol |
| IUPAC name | 2,2,3,3,3-pentafluoro-N-(3,4,5-trifluorophenyl)propanamide |
| InChIKey | FRDNQNHGZPGINK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)F)NC(=O)C(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)