Products 19430-76-3

CAS 19430-76-3 is the registry number for 4-Bromophenyl dichlorophosphate, 99%+(GC-MS),RG, 99%+(GC-MS),RG. Offered by: Chemat. Available pack sizes: 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

1-bromo-4-dichlorophosphoryloxybenzene (CAS 19430-76-3) is a chemical compound with the molecular formula C6H4BrCl2O2P and a molecular weight of 289.88 g/mol. IUPAC name: 1-bromo-4-dichlorophosphoryloxybenzene. InChIKey: PKNUXPMVXYHORS-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4BrCl2O2P
Molecular weight289.88 g/mol
IUPAC name1-bromo-4-dichlorophosphoryloxybenzene
InChIKeyPKNUXPMVXYHORS-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1OP(=O)(Cl)Cl)Br

Computed by PubChem (NCBI)