CAS 19430-76-3 is the registry number for 4-Bromophenyl dichlorophosphate, 99%+(GC-MS),RG, 99%+(GC-MS),RG. Offered by: Chemat. Available pack sizes: 1g, 5g, 25g.
1-bromo-4-dichlorophosphoryloxybenzene (CAS 19430-76-3) is a chemical compound with the molecular formula C6H4BrCl2O2P and a molecular weight of 289.88 g/mol. IUPAC name: 1-bromo-4-dichlorophosphoryloxybenzene. InChIKey: PKNUXPMVXYHORS-UHFFFAOYSA-N.
| Molecular formula | C6H4BrCl2O2P |
|---|---|
| Molecular weight | 289.88 g/mol |
| IUPAC name | 1-bromo-4-dichlorophosphoryloxybenzene |
| InChIKey | PKNUXPMVXYHORS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OP(=O)(Cl)Cl)Br |
Computed by PubChem (NCBI)