CAS 194351-51-4 is the registry number for N-2-Ethoxyethyl-Val-Ala-anilide. Offered by: Creative Peptides, Biosynth. Available pack sizes: on request, 50mg, 25mg, 100mg, 250mg.
(2S)-N-[(2S)-1-anilino-1-oxopropan-2-yl]-2-(2-ethoxyethylamino)-3-methylbutanamide (CAS 194351-51-4) is a chemical compound with the molecular formula C18H29N3O3 and a molecular weight of 335.4 g/mol. IUPAC name: (2S)-N-[(2S)-1-anilino-1-oxopropan-2-yl]-2-(2-ethoxyethylamino)-3-methylbutanamide. InChIKey: ZYRCZFNWEPUEFA-HOCLYGCPSA-N.
| Molecular formula | C18H29N3O3 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | (2S)-N-[(2S)-1-anilino-1-oxopropan-2-yl]-2-(2-ethoxyethylamino)-3-methylbutanamide |
| InChIKey | ZYRCZFNWEPUEFA-HOCLYGCPSA-N |
| SMILES | CCOCCN[C@@H](C(C)C)C(=O)N[C@@H](C)C(=O)NC1=CC=CC=C1 |
Computed by PubChem (NCBI)