Products 1944-11-2
CAS 1944-11-2 is the registry number for Fenoterol EP Impurity B HCl. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3,5-dihydroxyphenyl)-2-[1-(4-hydroxyphenyl)propan-2-ylamino]ethanone;hydrochloride (CAS 1944-11-2) is a chemical compound with the molecular formula C17H20ClNO4 and a molecular weight of 337.8 g/mol. IUPAC name: 1-(3,5-dihydroxyphenyl)-2-[1-(4-hydroxyphenyl)propan-2-ylamino]ethanone;hydrochloride. InChIKey: HYIMJIJRUZFTDC-UHFFFAOYSA-N.
| Molecular formula | C17H20ClNO4 |
|---|---|
| Molecular weight | 337.8 g/mol |
| IUPAC name | 1-(3,5-dihydroxyphenyl)-2-[1-(4-hydroxyphenyl)propan-2-ylamino]ethanone;hydrochloride |
| InChIKey | HYIMJIJRUZFTDC-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC=C(C=C1)O)NCC(=O)C2=CC(=CC(=C2)O)O.Cl |
Computed by PubChem (NCBI)