Products 194482-44-5
CAS 194482-44-5 is the registry number for PNU-200579. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-hydroxybenzoic acid (CAS 194482-44-5) is a chemical compound with the molecular formula C22H29NO3 and a molecular weight of 355.5 g/mol. IUPAC name: 3-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-hydroxybenzoic acid. InChIKey: NKTNTJFTBRPQIZ-LJQANCHMSA-N.
| Molecular formula | C22H29NO3 |
|---|---|
| Molecular weight | 355.5 g/mol |
| IUPAC name | 3-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-hydroxybenzoic acid |
| InChIKey | NKTNTJFTBRPQIZ-LJQANCHMSA-N |
| SMILES | CC(C)N(CC[C@H](C1=CC=CC=C1)C2=C(C=CC(=C2)C(=O)O)O)C(C)C |
Computed by PubChem (NCBI)