CAS 19458-49-2 appears in our catalog under these names: 17,20:20,21-Bis(methylenedioxy)-5b-pregnan-3b-ol, 17,20:20,21-Bis(methylenedioxy)-5Beta-pregnan-3Beta-ol. Offered by: TRC. Available pack sizes: 100mg, 25mg, 5mg.
CAS 19458-49-2 identifies a chemical compound with the molecular formula C23H36O5 and a molecular weight of 392.5 g/mol. InChIKey: BMASJGTXZQYHKW-VGRYNZERSA-N.
| Molecular formula | C23H36O5 |
|---|---|
| Molecular weight | 392.5 g/mol |
| InChIKey | BMASJGTXZQYHKW-VGRYNZERSA-N |
| SMILES | C[C@]12CC[C@@H](C[C@H]1CC[C@@H]3C2CC[C@]4([C@H]3CC[C@]45C6(COCO6)OCO5)C)O |
Computed by PubChem (NCBI)