CAS 212310-16-2 appears in our catalog under these names: CAY10408, EP2 receptor agonist 4. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, Get quote.
(Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E,4R)-4-hydroxy-4-(1-propylcyclobutyl)but-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid (CAS 212310-16-2) is a chemical compound with the molecular formula C23H36O5 and a molecular weight of 392.5 g/mol. IUPAC name: (Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E,4R)-4-hydroxy-4-(1-propylcyclobutyl)but-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid. InChIKey: HJVBXPOYFHMZAS-QTUFFCAPSA-N.
| Molecular formula | C23H36O5 |
|---|---|
| Molecular weight | 392.5 g/mol |
| IUPAC name | (Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E,4R)-4-hydroxy-4-(1-propylcyclobutyl)but-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid |
| InChIKey | HJVBXPOYFHMZAS-QTUFFCAPSA-N |
| SMILES | CCCC1(CCC1)[C@@H](C/C=C/[C@H]2[C@@H](CC(=O)[C@@H]2C/C=C\CCCC(=O)O)O)O |
Computed by PubChem (NCBI)