Products 19467-38-0

CAS 19467-38-0 is the registry number for Glycerol Impurity 2 . Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[2-hydroxy-3-[(Z)-octadec-9-enoyl]oxypropyl]-trimethylazanium chloride (CAS 19467-38-0) is a chemical compound with the molecular formula C24H48ClNO3 and a molecular weight of 434.1 g/mol. IUPAC name: [2-hydroxy-3-[(Z)-octadec-9-enoyl]oxypropyl]-trimethylazanium chloride. InChIKey: OYUNFRDRYWKVEV-USGGBSEESA-M.

Identity
Molecular formulaC24H48ClNO3
Molecular weight434.1 g/mol
IUPAC name[2-hydroxy-3-[(Z)-octadec-9-enoyl]oxypropyl]-trimethylazanium chloride
InChIKeyOYUNFRDRYWKVEV-USGGBSEESA-M
SMILESCCCCCCCC/C=C\CCCCCCCC(=O)OCC(C[N+](C)(C)C)O.[Cl-]

Computed by PubChem (NCBI)