Products 1946843-41-9
CAS 1946843-41-9 is the registry number for 2-Iodonitrobenzene-d4, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.
1,2,3,4-tetradeuterio-5-iodo-6-nitrobenzene (CAS 1946843-41-9) is a chemical compound with the molecular formula C6H4INO2 and a molecular weight of 253.03 g/mol. IUPAC name: 1,2,3,4-tetradeuterio-5-iodo-6-nitrobenzene. InChIKey: JXMZUNPWVXQADG-RHQRLBAQSA-N.
| Molecular formula | C6H4INO2 |
|---|---|
| Molecular weight | 253.03 g/mol |
| IUPAC name | 1,2,3,4-tetradeuterio-5-iodo-6-nitrobenzene |
| InChIKey | JXMZUNPWVXQADG-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[N+](=O)[O-])I)[2H])[2H] |
Computed by PubChem (NCBI)