CAS 194787-05-8 appears in our catalog under these names: Ammonium Acetate-d7, Ammonium Acetate-d7, 98 atom % D, min 98% Chemical Purity, Ammonium acetate–d?, Ammoniumacetate-d7 98 atom % D, AMMONIUM-D4 ACETATE-D3, 98 ATOM % D. Offered by: TRC, CDN, GLPBio, Deutero, Biosynth. Available pack sizes: 100mg, 500mg, 50mg, 5g, 1g, 2g, 500 mg, 1 g.
CAS 194787-05-8 identifies a chemical compound with the molecular formula C2H7NO2 and a molecular weight of 84.13 g/mol. InChIKey: USFZMSVCRYTOJT-KYWLLVRESA-N.
| Molecular formula | C2H7NO2 |
|---|---|
| Molecular weight | 84.13 g/mol |
| InChIKey | USFZMSVCRYTOJT-KYWLLVRESA-N |
| SMILES | [2H]C([2H])([2H])C(=O)O[2H].[2H]N([2H])[2H] |
Computed by PubChem (NCBI)