Products 194793-95-8
CAS 194793-95-8 appears in our catalog under these names: n-Heptyl-d15 Alcohol, 98 atom % D, min 98% Chemical Purity, 1-Heptanol-d15, 99.0%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 25 mg, 10 mg, 50 mg.
1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecadeuterioheptan-1-ol (CAS 194793-95-8) is a chemical compound with the molecular formula C7H16O and a molecular weight of 131.29 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecadeuterioheptan-1-ol. InChIKey: BBMCTIGTTCKYKF-PMELWRBQSA-N.
| Molecular formula | C7H16O |
|---|---|
| Molecular weight | 131.29 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecadeuterioheptan-1-ol |
| InChIKey | BBMCTIGTTCKYKF-PMELWRBQSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])O |
Computed by PubChem (NCBI)