CAS 194796-34-4 is the registry number for 2,2'-((2,6-Dichlorophenyl)methylene)bis(1H-pyrrole), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(2,6-dichlorophenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole (CAS 194796-34-4) is a chemical compound with the molecular formula C15H12Cl2N2 and a molecular weight of 291.2 g/mol. IUPAC name: 2-[(2,6-dichlorophenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole. InChIKey: QKFBCUMWZFKVRJ-UHFFFAOYSA-N.
| Molecular formula | C15H12Cl2N2 |
|---|---|
| Molecular weight | 291.2 g/mol |
| IUPAC name | 2-[(2,6-dichlorophenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole |
| InChIKey | QKFBCUMWZFKVRJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C(C2=CC=CN2)C3=CC=CN3)Cl |
Computed by PubChem (NCBI)