CAS 19480-40-1 appears in our catalog under these names: 2,4-DB Potassium Salt, 2,4-Db potassium. Offered by: TRC, Biosynth. Available pack sizes: 1g, 1000mg.
Potassium 4-(2,4-dichlorophenoxy)butanoate (CAS 19480-40-1) is a chemical compound with the molecular formula C10H9Cl2KO3 and a molecular weight of 287.18 g/mol. IUPAC name: potassium 4-(2,4-dichlorophenoxy)butanoate. InChIKey: WRBJKRRJBCSNLE-UHFFFAOYSA-M.
| Molecular formula | C10H9Cl2KO3 |
|---|---|
| Molecular weight | 287.18 g/mol |
| IUPAC name | potassium 4-(2,4-dichlorophenoxy)butanoate |
| InChIKey | WRBJKRRJBCSNLE-UHFFFAOYSA-M |
| SMILES | C1=CC(=C(C=C1Cl)Cl)OCCCC(=O)[O-].[K+] |
Computed by PubChem (NCBI)