Products 1949-20-8
CAS 1949-20-8 appears in our catalog under these names: Oxolamine Citrate, Oxolamine Citrate, >95% (HPLC), Oxolamine citrate/ 99.33% (existing batch purity), Oxolamine citrate (SKF–9976 citrate), Oxolamine citrate salt. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 10g, 1g, 25g, 200mg, 500mg, 10mM (in 1ml dmso), 1 g.
N,N-diethyl-2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid (CAS 1949-20-8) is a chemical compound with the molecular formula C20H27N3O8 and a molecular weight of 437.4 g/mol. IUPAC name: N,N-diethyl-2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid. InChIKey: RBZIGQJSMCOHSS-UHFFFAOYSA-N.
| Molecular formula | C20H27N3O8 |
|---|---|
| Molecular weight | 437.4 g/mol |
| IUPAC name | N,N-diethyl-2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid |
| InChIKey | RBZIGQJSMCOHSS-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCC1=NC(=NO1)C2=CC=CC=C2.C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
Computed by PubChem (NCBI)