Products 19492-87-6

CAS 19492-87-6 is the registry number for 5-​Bromo-​benzo(b)​thiophene 1,​1-​dioxide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

5-bromo-1-benzothiophene 1,1-dioxide (CAS 19492-87-6) is a chemical compound with the molecular formula C8H5BrO2S and a molecular weight of 245.09 g/mol. IUPAC name: 5-bromo-1-benzothiophene 1,1-dioxide. InChIKey: SHMDLUBMDUJLOG-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5BrO2S
Molecular weight245.09 g/mol
IUPAC name5-bromo-1-benzothiophene 1,1-dioxide
InChIKeySHMDLUBMDUJLOG-UHFFFAOYSA-N
SMILESC1=CC2=C(C=CS2(=O)=O)C=C1Br

Computed by PubChem (NCBI)