Products 194930-04-6
CAS 194930-04-6 appears in our catalog under these names: rac Rivastigmine-d6, >95% (HPLC), (rac)–Rivastigmine–d6, (Rac)-Rivastigmine-d6. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
[3-[1-[bis(trideuteriomethyl)amino]ethyl]phenyl] N-ethyl-N-methylcarbamate (CAS 194930-04-6) is a chemical compound with the molecular formula C14H22N2O2 and a molecular weight of 256.37 g/mol. IUPAC name: [3-[1-[bis(trideuteriomethyl)amino]ethyl]phenyl] N-ethyl-N-methylcarbamate. InChIKey: XSVMFMHYUFZWBK-LIJFRPJRSA-N.
| Molecular formula | C14H22N2O2 |
|---|---|
| Molecular weight | 256.37 g/mol |
| IUPAC name | [3-[1-[bis(trideuteriomethyl)amino]ethyl]phenyl] N-ethyl-N-methylcarbamate |
| InChIKey | XSVMFMHYUFZWBK-LIJFRPJRSA-N |
| SMILES | [2H]C([2H])([2H])N(C(C)C1=CC(=CC=C1)OC(=O)N(C)CC)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)