Products 1949750-57-5
CAS 1949750-57-5 is the registry number for 1,3-Dimethyl-1H-pyrazol-5-yl 2-(methylsulfonyl)-4-(trifluoromethyl) Benzoate. Offered by: TRC. Available pack sizes: 2,5g.
(2,5-dimethylpyrazol-3-yl) 2-methylsulfonyl-4-(trifluoromethyl)benzoate (CAS 1949750-57-5) is a chemical compound with the molecular formula C14H13F3N2O4S and a molecular weight of 362.33 g/mol. IUPAC name: (2,5-dimethylpyrazol-3-yl) 2-methylsulfonyl-4-(trifluoromethyl)benzoate. InChIKey: DBFHGSYWOBRNIB-UHFFFAOYSA-N.
| Molecular formula | C14H13F3N2O4S |
|---|---|
| Molecular weight | 362.33 g/mol |
| IUPAC name | (2,5-dimethylpyrazol-3-yl) 2-methylsulfonyl-4-(trifluoromethyl)benzoate |
| InChIKey | DBFHGSYWOBRNIB-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)OC(=O)C2=C(C=C(C=C2)C(F)(F)F)S(=O)(=O)C)C |
Computed by PubChem (NCBI)