CAS 194979-70-9 appears in our catalog under these names: (S)-Cpp sodium, (S)-CPP (sodium). Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, Get quote.
Sodium (2S)-2-chloro-3-phenylpropanoate (CAS 194979-70-9) is a chemical compound with the molecular formula C9H8ClNaO2 and a molecular weight of 206.60 g/mol. IUPAC name: sodium (2S)-2-chloro-3-phenylpropanoate. InChIKey: HMHPCHNNVOLTFC-QRPNPIFTSA-M.
| Molecular formula | C9H8ClNaO2 |
|---|---|
| Molecular weight | 206.60 g/mol |
| IUPAC name | sodium (2S)-2-chloro-3-phenylpropanoate |
| InChIKey | HMHPCHNNVOLTFC-QRPNPIFTSA-M |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)[O-])Cl.[Na+] |
Computed by PubChem (NCBI)