Products 1950574-55-6

CAS 1950574-55-6 appears in our catalog under these names: (3,3-dimethylcyclobutyl)boronic acid 97%, (3,3-dimethylcyclobutyl)boronic acid, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 500mg.

Structural formula: {0} (CAS {1})

(3,3-dimethylcyclobutyl)boronic acid (CAS 1950574-55-6) is a chemical compound with the molecular formula C6H13BO2 and a molecular weight of 127.98 g/mol. IUPAC name: (3,3-dimethylcyclobutyl)boronic acid. InChIKey: WDQDCDXDYCGXAS-UHFFFAOYSA-N.

Identity
Molecular formulaC6H13BO2
Molecular weight127.98 g/mol
IUPAC name(3,3-dimethylcyclobutyl)boronic acid
InChIKeyWDQDCDXDYCGXAS-UHFFFAOYSA-N
SMILESB(C1CC(C1)(C)C)(O)O

Computed by PubChem (NCBI)