CAS 1951424-84-2 is the registry number for tert-Butyl (1r,2r)-2-(4-(trifluoromethyl)benzyloxy)cyclohexylcarbamate, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl N-[(1R,2R)-2-[[4-(trifluoromethyl)phenyl]methoxy]cyclohexyl]carbamate (CAS 1951424-84-2) is a chemical compound with the molecular formula C19H26F3NO3 and a molecular weight of 373.4 g/mol. IUPAC name: tert-butyl N-[(1R,2R)-2-[[4-(trifluoromethyl)phenyl]methoxy]cyclohexyl]carbamate. InChIKey: PZDDIWBQJQTMST-HZPDHXFCSA-N.
| Molecular formula | C19H26F3NO3 |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | tert-butyl N-[(1R,2R)-2-[[4-(trifluoromethyl)phenyl]methoxy]cyclohexyl]carbamate |
| InChIKey | PZDDIWBQJQTMST-HZPDHXFCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCC[C@H]1OCC2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)