CAS 1951424-85-3 is the registry number for (R)-tert-Butyl 6-(aminomethyl)-2,2-dimethylmorpholine-4-carboxylate oxalate, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
Tert-butyl (6R)-6-(aminomethyl)-2,2-dimethylmorpholine-4-carboxylate;oxalic acid (CAS 1951424-85-3) is a chemical compound with the molecular formula C14H26N2O7 and a molecular weight of 334.37 g/mol. IUPAC name: tert-butyl (6R)-6-(aminomethyl)-2,2-dimethylmorpholine-4-carboxylate;oxalic acid. InChIKey: WQCZAAPKLLZPSE-SBSPUUFOSA-N.
| Molecular formula | C14H26N2O7 |
|---|---|
| Molecular weight | 334.37 g/mol |
| IUPAC name | tert-butyl (6R)-6-(aminomethyl)-2,2-dimethylmorpholine-4-carboxylate;oxalic acid |
| InChIKey | WQCZAAPKLLZPSE-SBSPUUFOSA-N |
| SMILES | CC1(CN(C[C@H](O1)CN)C(=O)OC(C)(C)C)C.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)