CAS 1951439-11-4 is the registry number for Rel-benzyl (3R,4S)-3-amino-4-methylpiperidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (3S,4R)-3-amino-4-methylpiperidine-1-carboxylate (CAS 1951439-11-4) is a chemical compound with the molecular formula C14H20N2O2 and a molecular weight of 248.32 g/mol. IUPAC name: benzyl (3S,4R)-3-amino-4-methylpiperidine-1-carboxylate. InChIKey: SRPCZFCRBYSYDY-DGCLKSJQSA-N.
| Molecular formula | C14H20N2O2 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | benzyl (3S,4R)-3-amino-4-methylpiperidine-1-carboxylate |
| InChIKey | SRPCZFCRBYSYDY-DGCLKSJQSA-N |
| SMILES | C[C@@H]1CCN(C[C@H]1N)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)