CAS 1951439-15-8 is the registry number for 8-Iodo-imidazo[1,2-a]pyridin-6-ylamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
8-iodoimidazo[1,2-a]pyridin-6-amine;hydrochloride (CAS 1951439-15-8) is a chemical compound with the molecular formula C7H7ClIN3 and a molecular weight of 295.51 g/mol. IUPAC name: 8-iodoimidazo[1,2-a]pyridin-6-amine;hydrochloride. InChIKey: DDMCPNUCPRECPH-UHFFFAOYSA-N.
| Molecular formula | C7H7ClIN3 |
|---|---|
| Molecular weight | 295.51 g/mol |
| IUPAC name | 8-iodoimidazo[1,2-a]pyridin-6-amine;hydrochloride |
| InChIKey | DDMCPNUCPRECPH-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(C=C(C2=N1)I)N.Cl |
Computed by PubChem (NCBI)