Products 1951439-22-7
CAS 1951439-22-7 appears in our catalog under these names: Trans-3,4-dimethylpiperidin-3-ol hydrochloride, 95%, trans-3,4-dimethylpiperidin-3-ol hydrochloride, 97%, rac-(3R,4S)-3,4-Dimethylpiperidin-3-ol hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 100mg, 1g, 50mg, 0,5g.
(3S,4R)-3,4-dimethylpiperidin-3-ol;hydrochloride (CAS 1951439-22-7) is a chemical compound with the molecular formula C7H16ClNO and a molecular weight of 165.66 g/mol. IUPAC name: (3S,4R)-3,4-dimethylpiperidin-3-ol;hydrochloride. InChIKey: WFOORALUCWPZOR-ZJLYAJKPSA-N.
| Molecular formula | C7H16ClNO |
|---|---|
| Molecular weight | 165.66 g/mol |
| IUPAC name | (3S,4R)-3,4-dimethylpiperidin-3-ol;hydrochloride |
| InChIKey | WFOORALUCWPZOR-ZJLYAJKPSA-N |
| SMILES | C[C@@H]1CCNC[C@@]1(C)O.Cl |
Computed by PubChem (NCBI)