CAS 1951439-25-0 is the registry number for 4-nitropyridine hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-nitropyridine;hydrate (CAS 1951439-25-0) is a chemical compound with the molecular formula C5H6N2O3 and a molecular weight of 142.11 g/mol. IUPAC name: 4-nitropyridine;hydrate. InChIKey: ALRHVFAYUIVZON-UHFFFAOYSA-N.
| Molecular formula | C5H6N2O3 |
|---|---|
| Molecular weight | 142.11 g/mol |
| IUPAC name | 4-nitropyridine;hydrate |
| InChIKey | ALRHVFAYUIVZON-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1[N+](=O)[O-].O |
Computed by PubChem (NCBI)